Produkt-Name |
4-[4-(oxiran-2-ylmethoxy)phenyl]-1,2,3-thiadiazole |
Molekulare Formel |
C11H10N2O2S |
Molecular Weight |
234.2743 |
InChI |
InChI=1/C11H10N2O2S/c1-3-9(14-5-10-6-15-10)4-2-8(1)11-7-16-13-12-11/h1-4,7,10H,5-6H2 |
CAS Registry Number |
59834-07-0 |
Molecular Structure |
|
Dichte |
1.339g/cm3 |
Schmelzpunkt |
70℃ |
Siedepunkt |
405.6°C at 760 mmHg |
Brechungsindex |
1.613 |
Flammpunkt |
199.1°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|